....................................../////.===Hehe-Here===./////................................................ > < > < > < > < > < > < > < > < > < > < > < > < > < > < > < > < > < > < > < > < > < > < > < > < > < > < > < > < > < ------------------------------------------------------------------------------------------------------------------- /////////////////////////////////////////////////////////////////////////////////////////////////////////////////// RIFF¤ WEBPVP8 ˜ ðÑ *ôô>‘HŸK¥¤"§£±¨àð enü¹%½_F‘åè¿2ºQú³íªú`N¿­3ÿƒügµJžaÿ¯ÿ°~¼ÎùnúîÞÖô•òíôÁÉß®Sm¥Ü/ ‡ó˜f£Ùà<˜„xëJ¢Ù€SO3x<ªÔ©4¿+ç¶A`q@Ì“Úñè™ÍÿJÌ´ª-˜ÆtÊÛL]Ïq*‘Ý”ì#ŸÌÏãY]@ê`¿ /ªfkØB4·®£ó z—Üw¥Pxù–ÞLШKÇN¾AkÙTf½è'‰g gÆv›Øuh~ a˜Z— ïj*á¥t d£“uÒ ¨`K˜¹ßþ]b>˜]_ÏÔ6W—è2r4x•íÖ…"ƒÖNîä!¦å Ú}ýxGøÌ —@ ;ÆÚŠ=ɾ1ý8lªË¥ô ^yf®Œ¢u&2©nÙÇ›ñÂñŒ³ aPo['½»øFùà­+4ê“$!lövlüÞ=;N®3ð‚õ›DÉKòÞ>ÄÍ ¥ˆuߤ#ˆ$6ù™¥îЇy’ÍB¼ çxÛ;X"WL£R÷͝*ó-¶Zu}º.s¸sšXqù–DþÿvªhüïwyŸ ¯é³lÀ:KCûÄ£Ëá\…­ ~—ýóî ¼ûûÜTÓüÇy…ŽÆvc»¾×U ñ¸žþоP÷¦ó:Ò¨¨5;Ð#&#ÖúñläÿÁœ GxÉ­/ñ‡áQðìYÉtÒw޼GÔ´zàÒò ð*ëzƒ•4~H]Ø‹f ñÓÈñ`NåWçs'ÆÏW^ø¹!XžµmQ5ÃËoLœÎ: ÞËÍ¥J ù…î èo£ßPÎñ¶ž8.Œ]ʵ~5›ÙË-ù*8ÙÖß±~ ©¹rÓê‚j¶d¸{^Q'˜±Crß ÚH—#¥¥QlÀ×ëã‡DÜ«èî þ&Çæžî;ŽÏºò6ÒLÃXy&ZŒ'j‚¢Ù€IßÚù+–MGi‰*jE€‘JcÜ ÓÌ EÏÚj]o˜ Þr <¾U ûŪæÍ/šÝH¥˜b”¼ ÁñßX GP›ï2›4WŠÏà×£…íÓk†¦H·ÅíMh–*nó÷à]ÁjCº€b7<ب‹¨5車bp2:Á[UªM„QŒçiNMa#<5›áËó¸HýÊ"…×Éw¹¦ì2º–x<›»a±¸3Weü®FÝ⑱ö–î–³|LPÈ~çð~Çå‡|º kD¢µÏàÆAI %1À% ¹Ò – ”ϝS¦‰4&¶£°à Öý”û_Ò Áw°A«Å€?mÇÛgHÉ/8)á¾ÛìáöŽP í¨PŸNÙµº¦‡§Ùš"ÿ«>+ªÕ`Ê÷‡‚ß Õû˜þãÇ-PÍ.¾XV‘€ dÜ"þ4¹ ±Oú‘©t¥¦FªÄÃÄ•b‚znýu½—#cDs˜ÃiÑOˆñ×QO=*IAÊ,¶ŽZƒ;‡wøXè%EÐk:F±Ú” .Ѽ+Áu&Ç`."pÈÉw o&¿dE6‘’EqTuK@Ì¥ã™À(Êk(h‰,H}RÀIXÛš3µ1©_OqÚÒJAñ$ÊÙÜ;D3çŒ[þùœh¬Ã³™ö6ç†NY".Ú‰ï[ªŸŒ '²Ð öø_¨ÂÉ9ué¶³ÒŠõTàîMØ#û¯gN‡bÙ놚X„ö …ÉeüÌ^J ‹€.œ$Æ)βÄeæW#óüßĺŸ€ ÀzwV 9oä»f4V*uB «Ë†¹ì¯žR霓æHXa=&“I4K;¯ç‹h×·"UŠ~<•╪Vêª&ÍSÃÆÅ?ÔqÎ*mTM ˜›µwêd#[C¡©§‘D<©àb†–ÁœøvH/,í:¯( ²£|4-„Æövv„Yͼ™^Á$ˆ„¢Û[6yB.åH*V¨æ?$=˜Ñ€•ñ·­(VlŸ‘ nÀt8W÷´Bûba?q9ú¶Xƒl«ÿ\ù¶’þòUÐj/õ¢Ìµ³g$ƒÎR!¸»|Oߍë’BhîÚÑ¢ñåŒJ„®„£2Ð3•ô02Nt…!£Í]Ïc½Qÿ?ˆ<&ÃA¾Ú,JˆijÌ#5yz„‰Î|ÊŽ5QÏ:‹ÐaóVÔxW—CpeÏzÐïíçôÿÅ_[hãsÐ_/ŽTÝ?BîˆííV$<¿i>²F¬_Eß¿ †bÊŒº­ÿ®Z H“C}”¬,Mp ý/Bá£w>˜YV°aƒúh+cŠ- r/[%|üUMHäQ°X»|û/@|°¥Ð !BÔ Ç¢Ä©š+Õì D«7ìN¶ŽðÔ " ƶ’ÖçtA‰Û×}{tþz­¾GÍ›k¹OEJR$ Â׃ «ëÁ"oÉôž$oUK(Ä)Ãz³Ê-‹êN[Ò3Œñbï8P 4ƒ×q¢bo|?<ÛX¬òÄͰL–±›(™ûG?ýË©ÚÄ–ÂDØÐ_Ç¡ô ¾–ÄÏø ×e8Ë©$ÄF¹Å‹ì[©óìl:F¾f´‹‹Xì²ï®\¬ôùƒ ÿat¥óèÒùHß0äe‚;ü×h:ÆWðHž=Ã8骣"kœ'Y?³}Tûè€>?0l›e1Lòñ„aæKÆw…hÖŠùW…ÈÆÄ0ši·›[pcwËþñiêíY/~-Á5˜!¿†A›™Mÿþ(±“t@â“ö2­´TG5yé]çå僳 .·ÍïçÝ7UÚ±Ð/Nè»,_Ï ùdj7\ï Wì4›„»c¸àešg#ÒÊ⥭áØo5‘?ÌdÝô¯ ¹kzsƒ=´#ëÉK›Ø´±-¥eW?‡çßtòTã…$Ý+qÿ±ƒ÷_3Ô¥í÷:æ–ž<·Ö‡‰Å¢ š‡%Ô—utÌÈìðžgÖÀz²À—ï÷Óîäõ{K'´È÷³yaÏÁjƒô}ž§®æÊydÕÈë5¯èˆõvÕ©ã*çD„ “z„Ó‡^^xÂ3M§A´JG‚öï 3W'ˆ.OvXè¡ÊÕª?5º7†˜(˜Ç¶#çê’¶!ÌdZK§æ 0fãaN]òY³RV ™î$®K2R¨`W!1Ôó\;Ý ýB%qæK•&ÓÈe9È0êI±žeŸß -ú@žQr¦ ö4»M¼Áè¹µmw 9 EÆE_°2ó„ŸXKWÁ×Hóì^´²GѝF©óäR†¦‰ç"V»eØ<3ùd3ÿÚ¤Žú“Gi" —‘_ÙËÎ~Üö¯¥½Î»üŸEÚŽåmÞþí ;ÞólËΦMzA"Âf(´òá;Éï(/7½ûñÌ­cïÕçлþÝz¾-ÍvÑ“pH­–ðÓj$¸Äû¤‚‘ãUBË-n“2åPkS5&‹Â|+g^œ®Ì͆d!OïäîU«c;{Û!ÅŽ«ëZ9Ókóˆ]¯ƒ›né `ÇÒ+tÆš (ØKá¾—=3œ®•vuMñg²\ï Ec€ 05±d™‡×iÇ×›UúvÌ¢£Èþ¡ÕØô¶ßÎA"ß±#Ö²ˆÊŸ¦*Ä~ij|àø.-¼'»Ú¥£h ofº¦‡VsR=N½„Î v˜Z*SÌ{=jÑB‹tê…;’HžH¯8–îDù8ñ¢|Q•bÛçš–‹m³“ê¨ åÏ^m¬Žãþ©ïêO‡½6] µÆ„Ooòü ²x}N¦Ë3ïé¿»€›HA˜m%çÞ/¿í7Fø“‹léUk)É°Œµ8Q8›:ÀŠeT*šõ~ôڝG6 ¢}`ùH­–”¡k ‰P1>š†®9z11!X wKfmÁ¦xÑ,N1Q”–æB¶M…ÒÃv6SMˆhU¬ÊPŽï‘öj=·CŒ¯u¹ƒVIЃsx4’ömÛýcå¡¶7ßŠß 57^\wÒÐÆ k§h,Œý î«q^R½3]J¸ÇðN ‚çU¬ôº^Áì} ³f©Õœ§ˆã:FÄÈ‚é(€™?àýÓüè1Gô£¼éj‚OÅñ  #>×—ßtà 0G¥Åa뀐kßhc™À_ÉñÞ#±)GD" YîäË-ÿÙ̪ ¹™a¯´¢E\ÝÒö‚;™„ë]_ p8‰o¡ñ+^÷ 3‘'dT4œŽ ðVë½° :¬víÑ«£tßÚS-3¶“þ2 †üüʨòrš¹M{É_¤`Û¨0ìjœøJ‡:÷ÃáZ˜†@GP&œÑDGÏs¡þ¦þDGú‘1Yá9Ôþ¼ ûø…§÷8&–ÜÑnÄ_m®^üÆ`;ÉVÁJ£?â€-ßê}suÍ2sõA NÌúA磸‘îÿÚ»ƒìö·á¿±tÑÐ"Tÿü˜[@/äj¬€uüªìù¥Ý˜á8Ý´sõj 8@rˆð äþZÇD®ÿUÏ2ùôõrBzÆÏÞž>Ì™xœ“ wiÎ×7_… ¸ \#€MɁV¶¥üÕÿPÔ9Z‡ø§É8#H:ƒ5ÀÝå9ÍIŒ5åKÙŠ÷qÄ>1AÈøžj"µÂд/ªnÀ qªã}"iŸBå˜ÓÛŽ¦…&ݧ;G@—³b¯“•"´4í¨ôM¨åñC‹ïùÉó¯ÓsSH2Ý@ßáM‡ˆKÀªÛUeø/4\gnm¥‹ŸŒ qÄ b9ÞwÒNÏ_4Ég³ú=܆‚´ •â¥õeíþkjz>éÚyU«Íӝ݃6"8/ø{=Ô¢»G¥ äUw°W«,ô—¿ãㆅү¢³xŠUû™yŒ (øSópÐ 9\åTâ»—*oG$/×ÍT†Y¿1¤Þ¢_‡ ¼ „±ÍçèSaÓ 3ÛMÁBkxs‰’R/¡¤ˆÙçª(*õ„üXÌ´ƒ E§´¬EF"Ù”R/ÐNyÆÂ^°?™6¡œïJ·±$§?º>ÖüœcNÌù¯G ‹ñ2ЁBB„^·úìaz¨k:#¨Æ¨8LÎõލ£^§S&cŒÐU€ü(‡F±Š¼&P>8ÙÁ ‰ p5?0ÊÆƒZl¸aô š¼¡}gÿ¶zÆC²¹¬ÎÖG*HB¡O<º2#ñŒAƒ–¡B˜´É$¥›É:FÀÔx¾u?XÜÏÓvN©RS{2ʈãk9rmP¼Qq̳ è¼ÐFׄ^¡Öì fE“F4A…!ì/…¦Lƒ… … $%´¾yã@CI¬ á—3PþBÏNÿ<ý°4Ü ËÃ#ØÍ~âW«rEñw‹eùMMHß²`¬Öó½íf³:‹k˜¯÷}Z!ã¿<¥,\#öµÀ¯aÒNÆIé,Ћ–lŽ#Àæ9ÀÒS·I’½-Ïp Äz¤Š Â* ­íÄ9­< h>׍3ZkËU¹§˜ŒŠ±f­’¤º³Q ÏB?‹#µíÃ¥®@(Gs«†vI¥Mµ‹Á©e~2ú³ÁP4ìÕi‚²Ê^ö@-DþÓàlÜOÍ]n"µã:žpsŽ¢:! Aõ.ç~ÓBûH÷JCÌ]õVƒd «ú´QÙEA–¯¯Œ!.ˆˆëQ±ù œ·Ì!Õâ )ùL„ÅÀlÚè5@B…o´Æ¸XÓ&Û…O«˜”_#‡ƒ„ûÈt!¤ÁÏ›ÎÝŠ?c9 â\>lÓÁVÄÑ™£eØY]:fÝ–—ù+p{™ðè û³”g±OƒÚSù£áÁÊ„ä,ï7š²G ÕÌBk)~ÑiCµ|h#u¤¶îK¨² #²vݯGãeÖ϶ú…¾múÀ¶þÔñ‚Š9'^($¤§ò “š½{éúp÷J›ušS¹áªCÂubÃH9™D™/ZöØÁ‡¦ÝÙŸ·kð*_”.C‹{áXó€‡c¡c€§/šò/&éš÷,àéJþ‰X›fµ“C¨œ®r¬"kL‰Â_q…Z–.ÉL~O µ›zn‚¹À¦Öª7\àHµšÖ %»ÇníV[¥*Õ;ƒ#½¾HK-ÖIÊdÏEÚ#=o÷Óò³´Š: Ç?{¾+9›–‘OEáU·S€˜j"ÄaÜ ŒÛWt› á–c#a»pÔZÞdŽtWê=9éöÊ¢µ~ ë ;Öe‡Œ®:bî3±ýê¢wà¼îpêñ¹¾4 zc¾ðÖÿzdêŒÑÒŝÀ‰s6¤í³ÎÙB¿OZ”+F¤á‡3@Ñëäg©·Ž ˆèª<ù@É{&S„œÕúÀA)‰h:YÀ5^ÂÓŒ°õäU\ ùËÍû#²?Xe¬tu‰^zÒÔãë¼ÛWtEtû …‚g¶Úüâî*moGè¨7%u!]PhÏd™Ý%Îx: VÒ¦ôÊD3ÀŽKÛËãvÆî…N¯ä>Eró–ð`5 Œ%u5XkñÌ*NU%¶áœÊ:Qÿú»“úzyÏ6å-၇¾ ´ ÒÊ]y žO‘w2Äøæ…H’²f±ÎÇ.ª|¥'gîV•Ü .̘¯€šòü¤U~Ù†*¢!?ò wý,}´°ÔÞnïoKq5µb!áÓ3"vAßH¡³¡·G(ÐÎ0Îò¼MG!/ài®@—¬04*`…«é8ªøøló“ˆÊ”èù¤…ßÊoÿé'ËuÌÖ5×È¡§ˆˆfŽë9}hìâ_!!¯  B&Ëö¶‰ÀAÙNVŸ Wh›¸®XÑJì¨ú“¿÷3uj²˜¨ÍÎìë±aúŠÝå¯ð*Ó¨ôJ“yºØ)m°WýOè68†ŸÏ2—‰Ïüꪫٚ¥‹l1 ø ÏÄFjêµvÌbü¦èÝx:X±¢H=MÐß—,ˆÉÇ´(9ú¾^ÅÚ4¿m‡$âX‘å%(AlZo@½¨UOÌÕ”1ø¸jÎÀÃÃ_ µ‘Ü.œº¦Ut: Æï’!=¯uwû#,“pþÇúŒø(é@?³ü¥‘Mo §—s@Œ#)§ŒùkL}NOÆêA›¸~r½¼ÙA—HJ«eˆÖ´*¡ÓpÌŸö.m<-"³ûÈ$¬_6­åf£ïÚâj1y§ÕJ½@dÞÁr&Í\Z%D£Íñ·AZ Û³øüd/ªAi†/Й~  ‡âĮҮÏh§°b—›Û«mJžòG'[ÈYýŒ¦9psl ýÁ ®±f¦x,‰½tN ‚Xª9 ÙÖH.«Lo0×?͹m¡å†Ѽ+›2ƒF ±Ê8 7Hցϓ²Æ–m9…òŸï]Â1äN†VLâCˆU .ÿ‰Ts +ÅÎx(%¦u]6AF Š ØF鈄‘ |¢¶c±soŒ/t[a¾–û:s·`i햍ê›ËchÈ…8ßÀUÜewŒðNOƒõD%q#éû\9¤x¹&UE×G¥ Í—™$ð E6-‡¼!ýpãÔM˜ Âsìe¯ñµK¢Ç¡ùôléœ4Ö£”À Š®Ðc ^¨À}ÙËŸ§›ºê{ÊuÉC ×Sr€¤’fÉ*j!úÓ’Gsùìoîßîn%ò· àc Wp÷$¨˜)û»H ×8ŽÒ€Zj¤3ÀÙºY'Ql¦py{-6íÔCeiØp‘‡XÊîÆUߢ܂ž£Xé¼Y8þ©ëgñß}é.ÎógÒ„ÃØËø¯»™§Xýy M%@NŠ À(~áÐvu7&•,Ù˜ó€uP‡^^®=_E„jt’ 403WebShell
403Webshell
Server IP : 159.198.67.129  /  Your IP : 216.73.216.244
Web Server : LiteSpeed
System : Linux server166.web-hosting.com 4.18.0-513.18.1.lve.el8.x86_64 #1 SMP Thu Feb 22 12:55:50 UTC 2024 x86_64
User : trooaisr ( 4033)
PHP Version : 7.4.33
Disable Function : NONE
MySQL : OFF  |  cURL : ON  |  WGET : ON  |  Perl : ON  |  Python : ON  |  Sudo : OFF  |  Pkexec : OFF
Directory :  /opt/cloudlinux/venv/lib/python3.11/site-packages/numpy/polynomial/tests/

Upload File :
current_dir [ Writeable ] document_root [ Writeable ]

 

Command :


[ Back ]     

Current File : /opt/cloudlinux/venv/lib/python3.11/site-packages/numpy/polynomial/tests//test_printing.py
from math import nan, inf
import pytest
from numpy.core import array, arange, printoptions
import numpy.polynomial as poly
from numpy.testing import assert_equal, assert_

# For testing polynomial printing with object arrays
from fractions import Fraction
from decimal import Decimal


class TestStrUnicodeSuperSubscripts:

    @pytest.fixture(scope='class', autouse=True)
    def use_unicode(self):
        poly.set_default_printstyle('unicode')

    @pytest.mark.parametrize(('inp', 'tgt'), (
        ([1, 2, 3], "1.0 + 2.0·x + 3.0·x²"),
        ([-1, 0, 3, -1], "-1.0 + 0.0·x + 3.0·x² - 1.0·x³"),
        (arange(12), ("0.0 + 1.0·x + 2.0·x² + 3.0·x³ + 4.0·x⁴ + 5.0·x⁵ + "
                      "6.0·x⁶ + 7.0·x⁷ +\n8.0·x⁸ + 9.0·x⁹ + 10.0·x¹⁰ + "
                      "11.0·x¹¹")),
    ))
    def test_polynomial_str(self, inp, tgt):
        res = str(poly.Polynomial(inp))
        assert_equal(res, tgt)

    @pytest.mark.parametrize(('inp', 'tgt'), (
        ([1, 2, 3], "1.0 + 2.0·T₁(x) + 3.0·T₂(x)"),
        ([-1, 0, 3, -1], "-1.0 + 0.0·T₁(x) + 3.0·T₂(x) - 1.0·T₃(x)"),
        (arange(12), ("0.0 + 1.0·T₁(x) + 2.0·T₂(x) + 3.0·T₃(x) + 4.0·T₄(x) + "
                      "5.0·T₅(x) +\n6.0·T₆(x) + 7.0·T₇(x) + 8.0·T₈(x) + "
                      "9.0·T₉(x) + 10.0·T₁₀(x) + 11.0·T₁₁(x)")),
    ))
    def test_chebyshev_str(self, inp, tgt):
        res = str(poly.Chebyshev(inp))
        assert_equal(res, tgt)

    @pytest.mark.parametrize(('inp', 'tgt'), (
        ([1, 2, 3], "1.0 + 2.0·P₁(x) + 3.0·P₂(x)"),
        ([-1, 0, 3, -1], "-1.0 + 0.0·P₁(x) + 3.0·P₂(x) - 1.0·P₃(x)"),
        (arange(12), ("0.0 + 1.0·P₁(x) + 2.0·P₂(x) + 3.0·P₃(x) + 4.0·P₄(x) + "
                      "5.0·P₅(x) +\n6.0·P₆(x) + 7.0·P₇(x) + 8.0·P₈(x) + "
                      "9.0·P₉(x) + 10.0·P₁₀(x) + 11.0·P₁₁(x)")),
    ))
    def test_legendre_str(self, inp, tgt):
        res = str(poly.Legendre(inp))
        assert_equal(res, tgt)

    @pytest.mark.parametrize(('inp', 'tgt'), (
        ([1, 2, 3], "1.0 + 2.0·H₁(x) + 3.0·H₂(x)"),
        ([-1, 0, 3, -1], "-1.0 + 0.0·H₁(x) + 3.0·H₂(x) - 1.0·H₃(x)"),
        (arange(12), ("0.0 + 1.0·H₁(x) + 2.0·H₂(x) + 3.0·H₃(x) + 4.0·H₄(x) + "
                      "5.0·H₅(x) +\n6.0·H₆(x) + 7.0·H₇(x) + 8.0·H₈(x) + "
                      "9.0·H₉(x) + 10.0·H₁₀(x) + 11.0·H₁₁(x)")),
    ))
    def test_hermite_str(self, inp, tgt):
        res = str(poly.Hermite(inp))
        assert_equal(res, tgt)

    @pytest.mark.parametrize(('inp', 'tgt'), (
        ([1, 2, 3], "1.0 + 2.0·He₁(x) + 3.0·He₂(x)"),
        ([-1, 0, 3, -1], "-1.0 + 0.0·He₁(x) + 3.0·He₂(x) - 1.0·He₃(x)"),
        (arange(12), ("0.0 + 1.0·He₁(x) + 2.0·He₂(x) + 3.0·He₃(x) + "
                      "4.0·He₄(x) + 5.0·He₅(x) +\n6.0·He₆(x) + 7.0·He₇(x) + "
                      "8.0·He₈(x) + 9.0·He₉(x) + 10.0·He₁₀(x) +\n"
                      "11.0·He₁₁(x)")),
    ))
    def test_hermiteE_str(self, inp, tgt):
        res = str(poly.HermiteE(inp))
        assert_equal(res, tgt)

    @pytest.mark.parametrize(('inp', 'tgt'), (
        ([1, 2, 3], "1.0 + 2.0·L₁(x) + 3.0·L₂(x)"),
        ([-1, 0, 3, -1], "-1.0 + 0.0·L₁(x) + 3.0·L₂(x) - 1.0·L₃(x)"),
        (arange(12), ("0.0 + 1.0·L₁(x) + 2.0·L₂(x) + 3.0·L₃(x) + 4.0·L₄(x) + "
                      "5.0·L₅(x) +\n6.0·L₆(x) + 7.0·L₇(x) + 8.0·L₈(x) + "
                      "9.0·L₉(x) + 10.0·L₁₀(x) + 11.0·L₁₁(x)")),
    ))
    def test_laguerre_str(self, inp, tgt):
        res = str(poly.Laguerre(inp))
        assert_equal(res, tgt)


class TestStrAscii:

    @pytest.fixture(scope='class', autouse=True)
    def use_ascii(self):
        poly.set_default_printstyle('ascii')

    @pytest.mark.parametrize(('inp', 'tgt'), (
        ([1, 2, 3], "1.0 + 2.0 x + 3.0 x**2"),
        ([-1, 0, 3, -1], "-1.0 + 0.0 x + 3.0 x**2 - 1.0 x**3"),
        (arange(12), ("0.0 + 1.0 x + 2.0 x**2 + 3.0 x**3 + 4.0 x**4 + "
                      "5.0 x**5 + 6.0 x**6 +\n7.0 x**7 + 8.0 x**8 + "
                      "9.0 x**9 + 10.0 x**10 + 11.0 x**11")),
    ))
    def test_polynomial_str(self, inp, tgt):
        res = str(poly.Polynomial(inp))
        assert_equal(res, tgt)

    @pytest.mark.parametrize(('inp', 'tgt'), (
        ([1, 2, 3], "1.0 + 2.0 T_1(x) + 3.0 T_2(x)"),
        ([-1, 0, 3, -1], "-1.0 + 0.0 T_1(x) + 3.0 T_2(x) - 1.0 T_3(x)"),
        (arange(12), ("0.0 + 1.0 T_1(x) + 2.0 T_2(x) + 3.0 T_3(x) + "
                      "4.0 T_4(x) + 5.0 T_5(x) +\n6.0 T_6(x) + 7.0 T_7(x) + "
                      "8.0 T_8(x) + 9.0 T_9(x) + 10.0 T_10(x) +\n"
                      "11.0 T_11(x)")),
    ))
    def test_chebyshev_str(self, inp, tgt):
        res = str(poly.Chebyshev(inp))
        assert_equal(res, tgt)

    @pytest.mark.parametrize(('inp', 'tgt'), (
        ([1, 2, 3], "1.0 + 2.0 P_1(x) + 3.0 P_2(x)"),
        ([-1, 0, 3, -1], "-1.0 + 0.0 P_1(x) + 3.0 P_2(x) - 1.0 P_3(x)"),
        (arange(12), ("0.0 + 1.0 P_1(x) + 2.0 P_2(x) + 3.0 P_3(x) + "
                      "4.0 P_4(x) + 5.0 P_5(x) +\n6.0 P_6(x) + 7.0 P_7(x) + "
                      "8.0 P_8(x) + 9.0 P_9(x) + 10.0 P_10(x) +\n"
                      "11.0 P_11(x)")),
    ))
    def test_legendre_str(self, inp, tgt):
        res = str(poly.Legendre(inp))
        assert_equal(res, tgt)

    @pytest.mark.parametrize(('inp', 'tgt'), (
        ([1, 2, 3], "1.0 + 2.0 H_1(x) + 3.0 H_2(x)"),
        ([-1, 0, 3, -1], "-1.0 + 0.0 H_1(x) + 3.0 H_2(x) - 1.0 H_3(x)"),
        (arange(12), ("0.0 + 1.0 H_1(x) + 2.0 H_2(x) + 3.0 H_3(x) + "
                      "4.0 H_4(x) + 5.0 H_5(x) +\n6.0 H_6(x) + 7.0 H_7(x) + "
                      "8.0 H_8(x) + 9.0 H_9(x) + 10.0 H_10(x) +\n"
                      "11.0 H_11(x)")),
    ))
    def test_hermite_str(self, inp, tgt):
        res = str(poly.Hermite(inp))
        assert_equal(res, tgt)

    @pytest.mark.parametrize(('inp', 'tgt'), (
        ([1, 2, 3], "1.0 + 2.0 He_1(x) + 3.0 He_2(x)"),
        ([-1, 0, 3, -1], "-1.0 + 0.0 He_1(x) + 3.0 He_2(x) - 1.0 He_3(x)"),
        (arange(12), ("0.0 + 1.0 He_1(x) + 2.0 He_2(x) + 3.0 He_3(x) + "
                      "4.0 He_4(x) +\n5.0 He_5(x) + 6.0 He_6(x) + "
                      "7.0 He_7(x) + 8.0 He_8(x) + 9.0 He_9(x) +\n"
                      "10.0 He_10(x) + 11.0 He_11(x)")),
    ))
    def test_hermiteE_str(self, inp, tgt):
        res = str(poly.HermiteE(inp))
        assert_equal(res, tgt)

    @pytest.mark.parametrize(('inp', 'tgt'), (
        ([1, 2, 3], "1.0 + 2.0 L_1(x) + 3.0 L_2(x)"),
        ([-1, 0, 3, -1], "-1.0 + 0.0 L_1(x) + 3.0 L_2(x) - 1.0 L_3(x)"),
        (arange(12), ("0.0 + 1.0 L_1(x) + 2.0 L_2(x) + 3.0 L_3(x) + "
                      "4.0 L_4(x) + 5.0 L_5(x) +\n6.0 L_6(x) + 7.0 L_7(x) + "
                      "8.0 L_8(x) + 9.0 L_9(x) + 10.0 L_10(x) +\n"
                      "11.0 L_11(x)")),
    ))
    def test_laguerre_str(self, inp, tgt):
        res = str(poly.Laguerre(inp))
        assert_equal(res, tgt)


class TestLinebreaking:

    @pytest.fixture(scope='class', autouse=True)
    def use_ascii(self):
        poly.set_default_printstyle('ascii')

    def test_single_line_one_less(self):
        # With 'ascii' style, len(str(p)) is default linewidth - 1 (i.e. 74)
        p = poly.Polynomial([12345678, 12345678, 12345678, 12345678, 123])
        assert_equal(len(str(p)), 74)
        assert_equal(str(p), (
            '12345678.0 + 12345678.0 x + 12345678.0 x**2 + '
            '12345678.0 x**3 + 123.0 x**4'
        ))

    def test_num_chars_is_linewidth(self):
        # len(str(p)) == default linewidth == 75
        p = poly.Polynomial([12345678, 12345678, 12345678, 12345678, 1234])
        assert_equal(len(str(p)), 75)
        assert_equal(str(p), (
            '12345678.0 + 12345678.0 x + 12345678.0 x**2 + '
            '12345678.0 x**3 +\n1234.0 x**4'
        ))

    def test_first_linebreak_multiline_one_less_than_linewidth(self):
        # Multiline str where len(first_line) + len(next_term) == lw - 1 == 74
        p = poly.Polynomial(
                [12345678, 12345678, 12345678, 12345678, 1, 12345678]
            )
        assert_equal(len(str(p).split('\n')[0]), 74)
        assert_equal(str(p), (
            '12345678.0 + 12345678.0 x + 12345678.0 x**2 + '
            '12345678.0 x**3 + 1.0 x**4 +\n12345678.0 x**5'
        ))

    def test_first_linebreak_multiline_on_linewidth(self):
        # First line is one character longer than previous test
        p = poly.Polynomial(
                [12345678, 12345678, 12345678, 12345678.12, 1, 12345678]
            )
        assert_equal(str(p), (
            '12345678.0 + 12345678.0 x + 12345678.0 x**2 + '
            '12345678.12 x**3 +\n1.0 x**4 + 12345678.0 x**5'
        ))

    @pytest.mark.parametrize(('lw', 'tgt'), (
        (75, ('0.0 + 10.0 x + 200.0 x**2 + 3000.0 x**3 + 40000.0 x**4 + '
              '500000.0 x**5 +\n600000.0 x**6 + 70000.0 x**7 + 8000.0 x**8 + '
              '900.0 x**9')),
        (45, ('0.0 + 10.0 x + 200.0 x**2 + 3000.0 x**3 +\n40000.0 x**4 + '
              '500000.0 x**5 +\n600000.0 x**6 + 70000.0 x**7 + 8000.0 x**8 +\n'
              '900.0 x**9')),
        (132, ('0.0 + 10.0 x + 200.0 x**2 + 3000.0 x**3 + 40000.0 x**4 + '
               '500000.0 x**5 + 600000.0 x**6 + 70000.0 x**7 + 8000.0 x**8 + '
               '900.0 x**9')),
    ))
    def test_linewidth_printoption(self, lw, tgt):
        p = poly.Polynomial(
            [0, 10, 200, 3000, 40000, 500000, 600000, 70000, 8000, 900]
        )
        with printoptions(linewidth=lw):
            assert_equal(str(p), tgt)
            for line in str(p).split('\n'):
                assert_(len(line) < lw)


def test_set_default_printoptions():
    p = poly.Polynomial([1, 2, 3])
    c = poly.Chebyshev([1, 2, 3])
    poly.set_default_printstyle('ascii')
    assert_equal(str(p), "1.0 + 2.0 x + 3.0 x**2")
    assert_equal(str(c), "1.0 + 2.0 T_1(x) + 3.0 T_2(x)")
    poly.set_default_printstyle('unicode')
    assert_equal(str(p), "1.0 + 2.0·x + 3.0·x²")
    assert_equal(str(c), "1.0 + 2.0·T₁(x) + 3.0·T₂(x)")
    with pytest.raises(ValueError):
        poly.set_default_printstyle('invalid_input')


def test_complex_coefficients():
    """Test both numpy and built-in complex."""
    coefs = [0+1j, 1+1j, -2+2j, 3+0j]
    # numpy complex
    p1 = poly.Polynomial(coefs)
    # Python complex
    p2 = poly.Polynomial(array(coefs, dtype=object))
    poly.set_default_printstyle('unicode')
    assert_equal(str(p1), "1j + (1+1j)·x - (2-2j)·x² + (3+0j)·x³")
    assert_equal(str(p2), "1j + (1+1j)·x + (-2+2j)·x² + (3+0j)·x³")
    poly.set_default_printstyle('ascii')
    assert_equal(str(p1), "1j + (1+1j) x - (2-2j) x**2 + (3+0j) x**3")
    assert_equal(str(p2), "1j + (1+1j) x + (-2+2j) x**2 + (3+0j) x**3")


@pytest.mark.parametrize(('coefs', 'tgt'), (
    (array([Fraction(1, 2), Fraction(3, 4)], dtype=object), (
        "1/2 + 3/4·x"
    )),
    (array([1, 2, Fraction(5, 7)], dtype=object), (
        "1 + 2·x + 5/7·x²"
    )),
    (array([Decimal('1.00'), Decimal('2.2'), 3], dtype=object), (
        "1.00 + 2.2·x + 3·x²"
    )),
))
def test_numeric_object_coefficients(coefs, tgt):
    p = poly.Polynomial(coefs)
    poly.set_default_printstyle('unicode')
    assert_equal(str(p), tgt)


@pytest.mark.parametrize(('coefs', 'tgt'), (
    (array([1, 2, 'f'], dtype=object), '1 + 2·x + f·x²'),
    (array([1, 2, [3, 4]], dtype=object), '1 + 2·x + [3, 4]·x²'),
))
def test_nonnumeric_object_coefficients(coefs, tgt):
    """
    Test coef fallback for object arrays of non-numeric coefficients.
    """
    p = poly.Polynomial(coefs)
    poly.set_default_printstyle('unicode')
    assert_equal(str(p), tgt)


class TestFormat:
    def test_format_unicode(self):
        poly.set_default_printstyle('ascii')
        p = poly.Polynomial([1, 2, 0, -1])
        assert_equal(format(p, 'unicode'), "1.0 + 2.0·x + 0.0·x² - 1.0·x³")

    def test_format_ascii(self):
        poly.set_default_printstyle('unicode')
        p = poly.Polynomial([1, 2, 0, -1])
        assert_equal(
            format(p, 'ascii'), "1.0 + 2.0 x + 0.0 x**2 - 1.0 x**3"
        )

    def test_empty_formatstr(self):
        poly.set_default_printstyle('ascii')
        p = poly.Polynomial([1, 2, 3])
        assert_equal(format(p), "1.0 + 2.0 x + 3.0 x**2")
        assert_equal(f"{p}", "1.0 + 2.0 x + 3.0 x**2")

    def test_bad_formatstr(self):
        p = poly.Polynomial([1, 2, 0, -1])
        with pytest.raises(ValueError):
            format(p, '.2f')


@pytest.mark.parametrize(('poly', 'tgt'), (
    (poly.Polynomial, '1.0 + 2.0·z + 3.0·z²'),
    (poly.Chebyshev, '1.0 + 2.0·T₁(z) + 3.0·T₂(z)'),
    (poly.Hermite, '1.0 + 2.0·H₁(z) + 3.0·H₂(z)'),
    (poly.HermiteE, '1.0 + 2.0·He₁(z) + 3.0·He₂(z)'),
    (poly.Laguerre, '1.0 + 2.0·L₁(z) + 3.0·L₂(z)'),
    (poly.Legendre, '1.0 + 2.0·P₁(z) + 3.0·P₂(z)'),
))
def test_symbol(poly, tgt):
    p = poly([1, 2, 3], symbol='z')
    assert_equal(f"{p:unicode}", tgt)


class TestRepr:
    def test_polynomial_str(self):
        res = repr(poly.Polynomial([0, 1]))
        tgt = (
            "Polynomial([0., 1.], domain=[-1,  1], window=[-1,  1], "
            "symbol='x')"
        )
        assert_equal(res, tgt)

    def test_chebyshev_str(self):
        res = repr(poly.Chebyshev([0, 1]))
        tgt = (
            "Chebyshev([0., 1.], domain=[-1,  1], window=[-1,  1], "
            "symbol='x')"
        )
        assert_equal(res, tgt)

    def test_legendre_repr(self):
        res = repr(poly.Legendre([0, 1]))
        tgt = (
            "Legendre([0., 1.], domain=[-1,  1], window=[-1,  1], "
            "symbol='x')"
        )
        assert_equal(res, tgt)

    def test_hermite_repr(self):
        res = repr(poly.Hermite([0, 1]))
        tgt = (
            "Hermite([0., 1.], domain=[-1,  1], window=[-1,  1], "
            "symbol='x')"
        )
        assert_equal(res, tgt)

    def test_hermiteE_repr(self):
        res = repr(poly.HermiteE([0, 1]))
        tgt = (
            "HermiteE([0., 1.], domain=[-1,  1], window=[-1,  1], "
            "symbol='x')"
        )
        assert_equal(res, tgt)

    def test_laguerre_repr(self):
        res = repr(poly.Laguerre([0, 1]))
        tgt = (
            "Laguerre([0., 1.], domain=[0, 1], window=[0, 1], "
            "symbol='x')"
        )
        assert_equal(res, tgt)


class TestLatexRepr:
    """Test the latex repr used by Jupyter"""

    def as_latex(self, obj):
        # right now we ignore the formatting of scalars in our tests, since
        # it makes them too verbose. Ideally, the formatting of scalars will
        # be fixed such that tests below continue to pass
        obj._repr_latex_scalar = lambda x, parens=False: str(x)
        try:
            return obj._repr_latex_()
        finally:
            del obj._repr_latex_scalar

    def test_simple_polynomial(self):
        # default input
        p = poly.Polynomial([1, 2, 3])
        assert_equal(self.as_latex(p),
            r'$x \mapsto 1.0 + 2.0\,x + 3.0\,x^{2}$')

        # translated input
        p = poly.Polynomial([1, 2, 3], domain=[-2, 0])
        assert_equal(self.as_latex(p),
            r'$x \mapsto 1.0 + 2.0\,\left(1.0 + x\right) + 3.0\,\left(1.0 + x\right)^{2}$')

        # scaled input
        p = poly.Polynomial([1, 2, 3], domain=[-0.5, 0.5])
        assert_equal(self.as_latex(p),
            r'$x \mapsto 1.0 + 2.0\,\left(2.0x\right) + 3.0\,\left(2.0x\right)^{2}$')

        # affine input
        p = poly.Polynomial([1, 2, 3], domain=[-1, 0])
        assert_equal(self.as_latex(p),
            r'$x \mapsto 1.0 + 2.0\,\left(1.0 + 2.0x\right) + 3.0\,\left(1.0 + 2.0x\right)^{2}$')

    def test_basis_func(self):
        p = poly.Chebyshev([1, 2, 3])
        assert_equal(self.as_latex(p),
            r'$x \mapsto 1.0\,{T}_{0}(x) + 2.0\,{T}_{1}(x) + 3.0\,{T}_{2}(x)$')
        # affine input - check no surplus parens are added
        p = poly.Chebyshev([1, 2, 3], domain=[-1, 0])
        assert_equal(self.as_latex(p),
            r'$x \mapsto 1.0\,{T}_{0}(1.0 + 2.0x) + 2.0\,{T}_{1}(1.0 + 2.0x) + 3.0\,{T}_{2}(1.0 + 2.0x)$')

    def test_multichar_basis_func(self):
        p = poly.HermiteE([1, 2, 3])
        assert_equal(self.as_latex(p),
            r'$x \mapsto 1.0\,{He}_{0}(x) + 2.0\,{He}_{1}(x) + 3.0\,{He}_{2}(x)$')

    def test_symbol_basic(self):
        # default input
        p = poly.Polynomial([1, 2, 3], symbol='z')
        assert_equal(self.as_latex(p),
            r'$z \mapsto 1.0 + 2.0\,z + 3.0\,z^{2}$')

        # translated input
        p = poly.Polynomial([1, 2, 3], domain=[-2, 0], symbol='z')
        assert_equal(
            self.as_latex(p),
            (
                r'$z \mapsto 1.0 + 2.0\,\left(1.0 + z\right) + 3.0\,'
                r'\left(1.0 + z\right)^{2}$'
            ),
        )

        # scaled input
        p = poly.Polynomial([1, 2, 3], domain=[-0.5, 0.5], symbol='z')
        assert_equal(
            self.as_latex(p),
            (
                r'$z \mapsto 1.0 + 2.0\,\left(2.0z\right) + 3.0\,'
                r'\left(2.0z\right)^{2}$'
            ),
        )

        # affine input
        p = poly.Polynomial([1, 2, 3], domain=[-1, 0], symbol='z')
        assert_equal(
            self.as_latex(p),
            (
                r'$z \mapsto 1.0 + 2.0\,\left(1.0 + 2.0z\right) + 3.0\,'
                r'\left(1.0 + 2.0z\right)^{2}$'
            ),
        )


SWITCH_TO_EXP = (
    '1.0 + (1.0e-01) x + (1.0e-02) x**2',
    '1.2 + (1.2e-01) x + (1.2e-02) x**2',
    '1.23 + 0.12 x + (1.23e-02) x**2 + (1.23e-03) x**3',
    '1.235 + 0.123 x + (1.235e-02) x**2 + (1.235e-03) x**3',
    '1.2346 + 0.1235 x + 0.0123 x**2 + (1.2346e-03) x**3 + (1.2346e-04) x**4',
    '1.23457 + 0.12346 x + 0.01235 x**2 + (1.23457e-03) x**3 + '
    '(1.23457e-04) x**4',
    '1.234568 + 0.123457 x + 0.012346 x**2 + 0.001235 x**3 + '
    '(1.234568e-04) x**4 + (1.234568e-05) x**5',
    '1.2345679 + 0.1234568 x + 0.0123457 x**2 + 0.0012346 x**3 + '
    '(1.2345679e-04) x**4 + (1.2345679e-05) x**5')

class TestPrintOptions:
    """
    Test the output is properly configured via printoptions.
    The exponential notation is enabled automatically when the values 
    are too small or too large.
    """

    @pytest.fixture(scope='class', autouse=True)
    def use_ascii(self):
        poly.set_default_printstyle('ascii')

    def test_str(self):
        p = poly.Polynomial([1/2, 1/7, 1/7*10**8, 1/7*10**9])
        assert_equal(str(p), '0.5 + 0.14285714 x + 14285714.28571429 x**2 '
                             '+ (1.42857143e+08) x**3')

        with printoptions(precision=3):
            assert_equal(str(p), '0.5 + 0.143 x + 14285714.286 x**2 '
                                 '+ (1.429e+08) x**3')

    def test_latex(self):
        p = poly.Polynomial([1/2, 1/7, 1/7*10**8, 1/7*10**9])
        assert_equal(p._repr_latex_(),
            r'$x \mapsto \text{0.5} + \text{0.14285714}\,x + '
            r'\text{14285714.28571429}\,x^{2} + '
            r'\text{(1.42857143e+08)}\,x^{3}$')
        
        with printoptions(precision=3):
            assert_equal(p._repr_latex_(),
                r'$x \mapsto \text{0.5} + \text{0.143}\,x + '
                r'\text{14285714.286}\,x^{2} + \text{(1.429e+08)}\,x^{3}$')

    def test_fixed(self):
        p = poly.Polynomial([1/2])
        assert_equal(str(p), '0.5')
        
        with printoptions(floatmode='fixed'):
            assert_equal(str(p), '0.50000000')
        
        with printoptions(floatmode='fixed', precision=4):
            assert_equal(str(p), '0.5000')

    def test_switch_to_exp(self):
        for i, s in enumerate(SWITCH_TO_EXP):
            with printoptions(precision=i):
                p = poly.Polynomial([1.23456789*10**-i 
                                     for i in range(i//2+3)])
                assert str(p).replace('\n', ' ') == s 
    
    def test_non_finite(self):
        p = poly.Polynomial([nan, inf])
        assert str(p) == 'nan + inf x'
        assert p._repr_latex_() == r'$x \mapsto \text{nan} + \text{inf}\,x$'
        with printoptions(nanstr='NAN', infstr='INF'):
            assert str(p) == 'NAN + INF x'
            assert p._repr_latex_() == \
                r'$x \mapsto \text{NAN} + \text{INF}\,x$'

Youez - 2016 - github.com/yon3zu
LinuXploit